C13H18O6 — CID 173267332
1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate (PubChem CID 173267332) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate.
| Compound Name | 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267332 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate |
| SMILES | COCC(C)OOC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H18O6/c1-9(8-15-2)18-19-13(14)10-5-11(16-3)7-12(6-10)17-4/h5-7,9H,8H2,1-4H3 |
| InChIKey | MJOCNKBBPORJFA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|