1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate

C13H18O6 — CID 173267332

IUPAC1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate
SMILESCOCC(C)OOC(=O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C13H18O6/c1-9(8-15-2)18-19-13(14)10-5-11(16-3)7-12(6-10)17-4/h5-7,9H,8H2,1-4H3
InChIKeyMJOCNKBBPORJFA-UHFFFAOYSA-N
MW270.28 g/mol
LogP1.83
Rot. Bonds7

About 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate

1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate (PubChem CID 173267332) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate.

Molecular Properties

Compound Name1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate
PubChem CID173267332
Molecular FormulaC13H18O6
Molecular Weight270.28 g/mol
Exact Mass270.11
IUPAC Name1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate
SMILESCOCC(C)OOC(=O)c1cc(OC)cc(OC)c1
InChIInChI=1S/C13H18O6/c1-9(8-15-2)18-19-13(14)10-5-11(16-3)7-12(6-10)17-4/h5-7,9H,8H2,1-4H3
InChIKeyMJOCNKBBPORJFA-UHFFFAOYSA-N
XLogP1.83
TPSA63.22 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.28
LogP ≤ 51.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate?
The IUPAC name of 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate (CID 173267332) is 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate.
What is the SMILES notation for 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate?
The canonical SMILES for 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate is COCC(C)OOC(=O)c1cc(OC)cc(OC)c1.
What is the InChIKey of 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate?
The InChIKey is MJOCNKBBPORJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O6/c1-9(8-15-2)18-19-13(14)10-5-11(16-3)7-12(6-10)17-4/h5-7,9H,8H2,1-4H3.
What are the key properties of 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate?
1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate has a molecular weight of 270.28 g/mol, XLogP of 1.83, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 3,5-dimethoxybenzenecarboperoxoate is sourced from PubChem (CID 173267332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).