C33H38O12 — CID 57070142
5,6-bis[(3,5-dimethoxybenzoyl)oxy]hexyl 3,5-dimethoxybenzoate (PubChem CID 57070142) has the molecular formula C33H38O12 and a molecular weight of 626.66 g/mol. Its IUPAC name is 5,6-bis[(3,5-dimethoxybenzoyl)oxy]hexyl 3,5-dimethoxybenzoate.
| Compound Name | 5,6-bis[(3,5-dimethoxybenzoyl)oxy]hexyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 57070142 |
| Molecular Formula | C33H38O12 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 5,6-bis[(3,5-dimethoxybenzoyl)oxy]hexyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCCCCC(COC(=O)c2cc(OC)cc(OC)c2)OC(=O)c2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C33H38O12/c1-37-25-11-21(12-26(17-25)38-2)31(34)43-10-8-7-9-24(45-33(36)23-15-29(41-5)19-30(16-23)42-6)20-44-32(35)22-13-27(39-3)18-28(14-22)40-4/h11-19,24H,7-10,20H2,1-6H3 |
| InChIKey | AFRNBNJDJIYQKH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|