C23H28BrNO6 — CID 2789416
hexyl 4-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]benzoate (PubChem CID 2789416) has the molecular formula C23H28BrNO6 and a molecular weight of 494.38 g/mol. Its IUPAC name is hexyl 4-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]benzoate.
| Compound Name | hexyl 4-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 2789416 |
| Molecular Formula | C23H28BrNO6 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | hexyl 4-[(2-bromo-3,4,5-trimethoxybenzoyl)amino]benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2Br)cc1 |
| InChI | InChI=1S/C23H28BrNO6/c1-5-6-7-8-13-31-23(27)15-9-11-16(12-10-15)25-22(26)17-14-18(28-2)20(29-3)21(30-4)19(17)24/h9-12,14H,5-8,13H2,1-4H3,(H,25,26) |
| InChIKey | IJBIKZPMZLHCCJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|