C25H31NO5 — CID 4550624
octyl 4-[[3-(2-methoxyphenyl)-3-oxopropanoyl]amino]benzoate (PubChem CID 4550624) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is octyl 4-[[3-(2-methoxyphenyl)-3-oxopropanoyl]amino]benzoate.
| Compound Name | octyl 4-[[3-(2-methoxyphenyl)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 4550624 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | octyl 4-[[3-(2-methoxyphenyl)-3-oxopropanoyl]amino]benzoate |
| SMILES | CCCCCCCCOC(=O)c1ccc(NC(=O)CC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C25H31NO5/c1-3-4-5-6-7-10-17-31-25(29)19-13-15-20(16-14-19)26-24(28)18-22(27)21-11-8-9-12-23(21)30-2/h8-9,11-16H,3-7,10,17-18H2,1-2H3,(H,26,28) |
| InChIKey | KLUHVPXMEHXVBO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|