C24H29NO4 — CID 19237223
hexyl 4-[[2-(2-prop-2-enylphenoxy)acetyl]amino]benzoate (PubChem CID 19237223) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is hexyl 4-[[2-(2-prop-2-enylphenoxy)acetyl]amino]benzoate.
| Compound Name | hexyl 4-[[2-(2-prop-2-enylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19237223 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | hexyl 4-[[2-(2-prop-2-enylphenoxy)acetyl]amino]benzoate |
| SMILES | C=CCc1ccccc1OCC(=O)Nc1ccc(C(=O)OCCCCCC)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-3-5-6-9-17-28-24(27)20-13-15-21(16-14-20)25-23(26)18-29-22-12-8-7-11-19(22)10-4-2/h4,7-8,11-16H,2-3,5-6,9-10,17-18H2,1H3,(H,25,26) |
| InChIKey | SWNQAQJHEJRTLJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|