C16H14Br2ClNO4 — CID 53267535
2-bromo-N-(4-bromo-2-chlorophenyl)-3,4,5-trimethoxybenzamide (PubChem CID 53267535) has the molecular formula C16H14Br2ClNO4 and a molecular weight of 479.55 g/mol. Its IUPAC name is 2-bromo-N-(4-bromo-2-chlorophenyl)-3,4,5-trimethoxybenzamide.
| Compound Name | 2-bromo-N-(4-bromo-2-chlorophenyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 53267535 |
| Molecular Formula | C16H14Br2ClNO4 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 476.90 |
| IUPAC Name | 2-bromo-N-(4-bromo-2-chlorophenyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Br)cc2Cl)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C16H14Br2ClNO4/c1-22-12-7-9(13(18)15(24-3)14(12)23-2)16(21)20-11-5-4-8(17)6-10(11)19/h4-7H,1-3H3,(H,20,21) |
| InChIKey | UNXHNWYVGNXNKM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |