C16H28N4O4 — CID 69015345
3,4,5-tris(3-aminopropoxy)benzamide (PubChem CID 69015345) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3,4,5-tris(3-aminopropoxy)benzamide.
| Compound Name | 3,4,5-tris(3-aminopropoxy)benzamide |
|---|---|
| PubChem CID | 69015345 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 3,4,5-tris(3-aminopropoxy)benzamide |
| SMILES | NCCCOc1cc(C(N)=O)cc(OCCCN)c1OCCCN |
| InChI | InChI=1S/C16H28N4O4/c17-4-1-7-22-13-10-12(16(20)21)11-14(23-8-2-5-18)15(13)24-9-3-6-19/h10-11H,1-9,17-19H2,(H2,20,21) |
| InChIKey | UCCKOBVJXCXHRD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 148.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|