C11H13I2NO2 — CID 24834301
4-butoxy-3,5-diiodobenzamide (PubChem CID 24834301) has the molecular formula C11H13I2NO2 and a molecular weight of 445.04 g/mol. Its IUPAC name is 4-butoxy-3,5-diiodobenzamide.
| Compound Name | 4-butoxy-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 24834301 |
| Molecular Formula | C11H13I2NO2 |
| Molecular Weight | 445.04 g/mol |
| Exact Mass | 444.90 |
| IUPAC Name | 4-butoxy-3,5-diiodobenzamide |
| SMILES | CCCCOc1c(I)cc(C(N)=O)cc1I |
| InChI | InChI=1S/C11H13I2NO2/c1-2-3-4-16-10-8(12)5-7(11(14)15)6-9(10)13/h5-6H,2-4H2,1H3,(H2,14,15) |
| InChIKey | TXRDVPZODZRVTP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.04 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|