C13H19ClN3O2+ — CID 159005336
[4-amino-1-[4-(3-aminopropoxy)-3-chlorophenyl]-4-oxobutylidene]azanium (PubChem CID 159005336) has the molecular formula C13H19ClN3O2+ and a molecular weight of 284.77 g/mol. Its IUPAC name is [4-amino-1-[4-(3-aminopropoxy)-3-chlorophenyl]-4-oxobutylidene]azanium.
| Compound Name | [4-amino-1-[4-(3-aminopropoxy)-3-chlorophenyl]-4-oxobutylidene]azanium |
|---|---|
| PubChem CID | 159005336 |
| Molecular Formula | C13H19ClN3O2+ |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | [4-amino-1-[4-(3-aminopropoxy)-3-chlorophenyl]-4-oxobutylidene]azanium |
| SMILES | NCCCOc1ccc(C(=[NH2+])CCC(N)=O)cc1Cl |
| InChI | InChI=1S/C13H18ClN3O2/c14-10-8-9(11(16)3-5-13(17)18)2-4-12(10)19-7-1-6-15/h2,4,8,16H,1,3,5-7,15H2,(H2,17,18)/p+1 |
| InChIKey | JRVSZNWWPPVGIJ-UHFFFAOYSA-O |
| XLogP | -0.12 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|