C16H24ClN3O3 — CID 125155803
4-(3-aminopropoxy)-3-chloro-N-methyl-N-[(2S)-4-(methylamino)-4-oxobutan-2-yl]benzamide (PubChem CID 125155803) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is 4-(3-aminopropoxy)-3-chloro-N-methyl-N-[(2S)-4-(methylamino)-4-oxobutan-2-yl]benzamide.
| Compound Name | 4-(3-aminopropoxy)-3-chloro-N-methyl-N-[(2S)-4-(methylamino)-4-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 125155803 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-(3-aminopropoxy)-3-chloro-N-methyl-N-[(2S)-4-(methylamino)-4-oxobutan-2-yl]benzamide |
| SMILES | CNC(=O)C[C@H](C)N(C)C(=O)c1ccc(OCCCN)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClN3O3/c1-11(9-15(21)19-2)20(3)16(22)12-5-6-14(13(17)10-12)23-8-4-7-18/h5-6,10-11H,4,7-9,18H2,1-3H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | JRZXHMDNQWVXQZ-NSHDSACASA-N |
| XLogP | 1.66 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|