C12H17ClN2O — CID 119583428
N-(1-aminopropan-2-yl)-3-chloro-N,4-dimethylbenzamide (PubChem CID 119583428) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-3-chloro-N,4-dimethylbenzamide.
| Compound Name | N-(1-aminopropan-2-yl)-3-chloro-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 119583428 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-(1-aminopropan-2-yl)-3-chloro-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C(C)CN)cc1Cl |
| InChI | InChI=1S/C12H17ClN2O/c1-8-4-5-10(6-11(8)13)12(16)15(3)9(2)7-14/h4-6,9H,7,14H2,1-3H3 |
| InChIKey | BQJZGVZESZKDGX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |