C12H18N2O — CID 82507196
N-(1-aminopropan-2-yl)-N,3-dimethylbenzamide (PubChem CID 82507196) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N,3-dimethylbenzamide.
| Compound Name | N-(1-aminopropan-2-yl)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 82507196 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)C(C)CN)c1 |
| InChI | InChI=1S/C12H18N2O/c1-9-5-4-6-11(7-9)12(15)14(3)10(2)8-13/h4-7,10H,8,13H2,1-3H3 |
| InChIKey | UASBCFDUIJNRPU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |