C15H28N4O3 — CID 69014315
3,4,5-tris(3-aminopropoxy)aniline (PubChem CID 69014315) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 3,4,5-tris(3-aminopropoxy)aniline.
| Compound Name | 3,4,5-tris(3-aminopropoxy)aniline |
|---|---|
| PubChem CID | 69014315 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 3,4,5-tris(3-aminopropoxy)aniline |
| SMILES | NCCCOc1cc(N)cc(OCCCN)c1OCCCN |
| InChI | InChI=1S/C15H28N4O3/c16-4-1-7-20-13-10-12(19)11-14(21-8-2-5-17)15(13)22-9-3-6-18/h10-11H,1-9,16-19H2 |
| InChIKey | JJSMLVBHRDPIJL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|