C14H24N2O8S2 — CID 139991690
4-[3,5-diamino-2-(4-sulfobutoxy)phenoxy]butane-1-sulfonic acid (PubChem CID 139991690) has the molecular formula C14H24N2O8S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[3,5-diamino-2-(4-sulfobutoxy)phenoxy]butane-1-sulfonic acid.
| Compound Name | 4-[3,5-diamino-2-(4-sulfobutoxy)phenoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 139991690 |
| Molecular Formula | C14H24N2O8S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 4-[3,5-diamino-2-(4-sulfobutoxy)phenoxy]butane-1-sulfonic acid |
| SMILES | Nc1cc(N)c(OCCCCS(=O)(=O)O)c(OCCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H24N2O8S2/c15-11-9-12(16)14(24-6-2-4-8-26(20,21)22)13(10-11)23-5-1-3-7-25(17,18)19/h9-10H,1-8,15-16H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | UVDYZBSEZZZRIC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 179.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|