C30H32N2O8S2 — CID 101256760
3-[2-(4-aminophenyl)-5-[4-(4-aminophenyl)-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid (PubChem CID 101256760) has the molecular formula C30H32N2O8S2 and a molecular weight of 612.73 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)-5-[4-(4-aminophenyl)-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-(4-aminophenyl)-5-[4-(4-aminophenyl)-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 101256760 |
| Molecular Formula | C30H32N2O8S2 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | 3-[2-(4-aminophenyl)-5-[4-(4-aminophenyl)-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(-c4ccc(N)cc4)c(OCCCS(=O)(=O)O)c3)cc2OCCCS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C30H32N2O8S2/c31-25-9-3-21(4-10-25)27-13-7-23(19-29(27)39-15-1-17-41(33,34)35)24-8-14-28(22-5-11-26(32)12-6-22)30(20-24)40-16-2-18-42(36,37)38/h3-14,19-20H,1-2,15-18,31-32H2,(H,33,34,35)(H,36,37,38) |
| InChIKey | RIQSCBJJMKAIIO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 179.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|