C18H24N2O8S2 — CID 88995847
3-[5-amino-2-[4-amino-2-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid (PubChem CID 88995847) has the molecular formula C18H24N2O8S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-[5-amino-2-[4-amino-2-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[5-amino-2-[4-amino-2-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88995847 |
| Molecular Formula | C18H24N2O8S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 3-[5-amino-2-[4-amino-2-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid |
| SMILES | Nc1ccc(-c2ccc(N)cc2OCCCS(=O)(=O)O)c(OCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H24N2O8S2/c19-13-3-5-15(17(11-13)27-7-1-9-29(21,22)23)16-6-4-14(20)12-18(16)28-8-2-10-30(24,25)26/h3-6,11-12H,1-2,7-10,19-20H2,(H,21,22,23)(H,24,25,26) |
| InChIKey | UOQSEWMPXARXID-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 179.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|