C20H26O8S2 — CID 167151939
3-[2-methyl-5-[4-methyl-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid (PubChem CID 167151939) has the molecular formula C20H26O8S2 and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-[2-methyl-5-[4-methyl-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-methyl-5-[4-methyl-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 167151939 |
| Molecular Formula | C20H26O8S2 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 3-[2-methyl-5-[4-methyl-3-(3-sulfopropoxy)phenyl]phenoxy]propane-1-sulfonic acid |
| SMILES | Cc1ccc(-c2ccc(C)c(OCCCS(=O)(=O)O)c2)cc1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C20H26O8S2/c1-15-5-7-17(13-19(15)27-9-3-11-29(21,22)23)18-8-6-16(2)20(14-18)28-10-4-12-30(24,25)26/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | QYXZNLZDLVGZGO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|