C25H26O5S — CID 59648721
3-[5-methyl-2-[[4-(4-methylbenzoyl)phenyl]methyl]phenoxy]propane-1-sulfonic acid (PubChem CID 59648721) has the molecular formula C25H26O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-[5-methyl-2-[[4-(4-methylbenzoyl)phenyl]methyl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[5-methyl-2-[[4-(4-methylbenzoyl)phenyl]methyl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59648721 |
| Molecular Formula | C25H26O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-[5-methyl-2-[[4-(4-methylbenzoyl)phenyl]methyl]phenoxy]propane-1-sulfonic acid |
| SMILES | Cc1ccc(C(=O)c2ccc(Cc3ccc(C)cc3OCCCS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H26O5S/c1-18-4-9-21(10-5-18)25(26)22-12-7-20(8-13-22)17-23-11-6-19(2)16-24(23)30-14-3-15-31(27,28)29/h4-13,16H,3,14-15,17H2,1-2H3,(H,27,28,29) |
| InChIKey | LJCZFZBFQXHXOI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|