C22H20O — CID 54157138
(3-methylphenyl)-[4-[(4-methylphenyl)methyl]phenyl]methanone (PubChem CID 54157138) has the molecular formula C22H20O and a molecular weight of 300.40 g/mol. Its IUPAC name is (3-methylphenyl)-[4-[(4-methylphenyl)methyl]phenyl]methanone.
| Compound Name | (3-methylphenyl)-[4-[(4-methylphenyl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 54157138 |
| Molecular Formula | C22H20O |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (3-methylphenyl)-[4-[(4-methylphenyl)methyl]phenyl]methanone |
| SMILES | Cc1ccc(Cc2ccc(C(=O)c3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C22H20O/c1-16-6-8-18(9-7-16)15-19-10-12-20(13-11-19)22(23)21-5-3-4-17(2)14-21/h3-14H,15H2,1-2H3 |
| InChIKey | OLWHFPIIRCIIJK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |