C22H18BO — CID 70870278
CID 70870278 (PubChem CID 70870278) has the molecular formula C22H18BO and a molecular weight of 309.20 g/mol.
| Compound Name | CID 70870278 |
|---|---|
| PubChem CID | 70870278 |
| Molecular Formula | C22H18BO |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | — |
| SMILES | [B]=C(c1ccc(C)cc1)c1cccc(C(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H18BO/c1-15-6-10-17(11-7-15)21(23)19-4-3-5-20(14-19)22(24)18-12-8-16(2)9-13-18/h3-14H,1-2H3 |
| InChIKey | NXPMKBKFJAGGRY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|