C29H40O8S — CID 159165135
3-[5-[7-(4-methylphenyl)-7-oxoheptanoyl]-2,3-dipropoxyphenoxy]propane-1-sulfonic acid (PubChem CID 159165135) has the molecular formula C29H40O8S and a molecular weight of 548.70 g/mol. Its IUPAC name is 3-[5-[7-(4-methylphenyl)-7-oxoheptanoyl]-2,3-dipropoxyphenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[5-[7-(4-methylphenyl)-7-oxoheptanoyl]-2,3-dipropoxyphenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 159165135 |
| Molecular Formula | C29H40O8S |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 3-[5-[7-(4-methylphenyl)-7-oxoheptanoyl]-2,3-dipropoxyphenoxy]propane-1-sulfonic acid |
| SMILES | CCCOc1cc(C(=O)CCCCCC(=O)c2ccc(C)cc2)cc(OCCCS(=O)(=O)O)c1OCCC |
| InChI | InChI=1S/C29H40O8S/c1-4-16-35-27-20-24(21-28(29(27)37-17-5-2)36-18-9-19-38(32,33)34)26(31)11-8-6-7-10-25(30)23-14-12-22(3)13-15-23/h12-15,20-21H,4-11,16-19H2,1-3H3,(H,32,33,34) |
| InChIKey | POFMKJBKDHHOBT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|