C20H31N3O13S3 — CID 158164860
3-[5-(5-azidopentanoyl)-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid (PubChem CID 158164860) has the molecular formula C20H31N3O13S3 and a molecular weight of 617.68 g/mol. Its IUPAC name is 3-[5-(5-azidopentanoyl)-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[5-(5-azidopentanoyl)-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 158164860 |
| Molecular Formula | C20H31N3O13S3 |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.10 |
| IUPAC Name | 3-[5-(5-azidopentanoyl)-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
| SMILES | [N-]=[N+]=NCCCCC(=O)c1cc(OCCCS(=O)(=O)O)c(OCCCS(=O)(=O)O)c(OCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H31N3O13S3/c21-23-22-7-2-1-6-17(24)16-14-18(34-8-3-11-37(25,26)27)20(36-10-5-13-39(31,32)33)19(15-16)35-9-4-12-38(28,29)30/h14-15H,1-13H2,(H,25,26,27)(H,28,29,30)(H,31,32,33) |
| InChIKey | GRQBWVLBPHYNGD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 256.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|