C25H28N6O7 — CID 15986962
(1E,4E)-1,5-bis[4-(2-azidoethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one (PubChem CID 15986962) has the molecular formula C25H28N6O7 and a molecular weight of 524.53 g/mol. Its IUPAC name is (1E,4E)-1,5-bis[4-(2-azidoethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis[4-(2-azidoethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 15986962 |
| Molecular Formula | C25H28N6O7 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (1E,4E)-1,5-bis[4-(2-azidoethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cc(OC)c(OCCN=[N+]=[N-])c(OC)c2)cc(OC)c1OCCN=[N+]=[N-] |
| InChI | InChI=1S/C25H28N6O7/c1-33-20-13-17(14-21(34-2)24(20)37-11-9-28-30-26)5-7-19(32)8-6-18-15-22(35-3)25(23(16-18)36-4)38-12-10-29-31-27/h5-8,13-16H,9-12H2,1-4H3/b7-5+,8-6+ |
| InChIKey | HXPURBVOUOJKTA-KQQUZDAGSA-N |
| XLogP | 5.39 |
| TPSA | 169.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|