C13H15N3O4 — CID 169462842
[4-(3-azidoprop-1-enyl)-2,6-dimethoxyphenyl] acetate (PubChem CID 169462842) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is [4-(3-azidoprop-1-enyl)-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-(3-azidoprop-1-enyl)-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 169462842 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | [4-(3-azidoprop-1-enyl)-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(C=CCN=[N+]=[N-])cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C13H15N3O4/c1-9(17)20-13-11(18-2)7-10(8-12(13)19-3)5-4-6-15-16-14/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | WBGXAYNPMYIEBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|