C34H28F4O8 — CID 59742494
[4-[(E)-2-[4-[(E)-2-(4-acetyloxy-3,5-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrafluoronaphthalen-1-yl]ethenyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 59742494) has the molecular formula C34H28F4O8 and a molecular weight of 640.58 g/mol. Its IUPAC name is [4-[(E)-2-[4-[(E)-2-(4-acetyloxy-3,5-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrafluoronaphthalen-1-yl]ethenyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(E)-2-[4-[(E)-2-(4-acetyloxy-3,5-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrafluoronaphthalen-1-yl]ethenyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 59742494 |
| Molecular Formula | C34H28F4O8 |
| Molecular Weight | 640.58 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | [4-[(E)-2-[4-[(E)-2-(4-acetyloxy-3,5-dimethoxyphenyl)ethenyl]-5,6,7,8-tetrafluoronaphthalen-1-yl]ethenyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/c2ccc(/C=C/c3cc(OC)c(OC(C)=O)c(OC)c3)c3c(F)c(F)c(F)c(F)c23)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C34H28F4O8/c1-17(39)45-33-23(41-3)13-19(14-24(33)42-4)7-9-21-11-12-22(28-27(21)29(35)31(37)32(38)30(28)36)10-8-20-15-25(43-5)34(46-18(2)40)26(16-20)44-6/h7-16H,1-6H3/b9-7+,10-8+ |
| InChIKey | DDKRTLVWMHULAG-FIFLTTCUSA-N |
| XLogP | 7.62 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.58 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|