C27H30O9 — CID 102029680
(1E,4E)-1,5-bis[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]penta-1,4-dien-3-one (PubChem CID 102029680) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is (1E,4E)-1,5-bis[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 102029680 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | (1E,4E)-1,5-bis[3,5-dimethoxy-4-(oxiran-2-ylmethoxy)phenyl]penta-1,4-dien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2cc(OC)c(OCC3CO3)c(OC)c2)cc(OC)c1OCC1CO1 |
| InChI | InChI=1S/C27H30O9/c1-29-22-9-17(10-23(30-2)26(22)35-15-20-13-33-20)5-7-19(28)8-6-18-11-24(31-3)27(25(12-18)32-4)36-16-21-14-34-21/h5-12,20-21H,13-16H2,1-4H3/b7-5+,8-6+ |
| InChIKey | UZYJMLKKKQSIQD-KQQUZDAGSA-N |
| XLogP | 3.57 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|