C24H30O8 — CID 145103096
2-[[4-[(E)-2-[4-(ethoxymethoxy)-3,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]methyl]oxirane (PubChem CID 145103096) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[[4-[(E)-2-[4-(ethoxymethoxy)-3,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[(E)-2-[4-(ethoxymethoxy)-3,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 145103096 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-[[4-[(E)-2-[4-(ethoxymethoxy)-3,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]methyl]oxirane |
| SMILES | CCOCOc1c(OC)cc(/C=C/c2cc(OC)c(OCC3CO3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H30O8/c1-6-29-15-32-24-21(27-4)11-17(12-22(24)28-5)8-7-16-9-19(25-2)23(20(10-16)26-3)31-14-18-13-30-18/h7-12,18H,6,13-15H2,1-5H3/b8-7+ |
| InChIKey | RAYMPFSLWXBPNT-BQYQJAHWSA-N |
| XLogP | 4.04 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|