C32H38O6 — CID 59189373
1,4-bis[2-(4-ethoxy-3,5-dimethoxyphenyl)ethenyl]-2,5-dimethylbenzene (PubChem CID 59189373) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is 1,4-bis[2-(4-ethoxy-3,5-dimethoxyphenyl)ethenyl]-2,5-dimethylbenzene.
| Compound Name | 1,4-bis[2-(4-ethoxy-3,5-dimethoxyphenyl)ethenyl]-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 59189373 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 1,4-bis[2-(4-ethoxy-3,5-dimethoxyphenyl)ethenyl]-2,5-dimethylbenzene |
| SMILES | CCOc1c(OC)cc(C=Cc2cc(C)c(C=Cc3cc(OC)c(OCC)c(OC)c3)cc2C)cc1OC |
| InChI | InChI=1S/C32H38O6/c1-9-37-31-27(33-5)17-23(18-28(31)34-6)11-13-25-15-22(4)26(16-21(25)3)14-12-24-19-29(35-7)32(38-10-2)30(20-24)36-8/h11-20H,9-10H2,1-8H3 |
| InChIKey | WWIMWZCNYBETMO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|