C21H26O3 — CID 144857589
5-[(E)-2-(4-butoxyphenyl)ethenyl]-1,2-dimethoxy-3-methylbenzene (PubChem CID 144857589) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-[(E)-2-(4-butoxyphenyl)ethenyl]-1,2-dimethoxy-3-methylbenzene.
| Compound Name | 5-[(E)-2-(4-butoxyphenyl)ethenyl]-1,2-dimethoxy-3-methylbenzene |
|---|---|
| PubChem CID | 144857589 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 5-[(E)-2-(4-butoxyphenyl)ethenyl]-1,2-dimethoxy-3-methylbenzene |
| SMILES | CCCCOc1ccc(/C=C/c2cc(C)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H26O3/c1-5-6-13-24-19-11-9-17(10-12-19)7-8-18-14-16(2)21(23-4)20(15-18)22-3/h7-12,14-15H,5-6,13H2,1-4H3/b8-7+ |
| InChIKey | ZVTUUALAMGGYNT-BQYQJAHWSA-N |
| XLogP | 5.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|