C30H32Br2O2 — CID 86600085
1,4-dibromo-2,5-bis[(E)-2-(4-butoxyphenyl)ethenyl]benzene (PubChem CID 86600085) has the molecular formula C30H32Br2O2 and a molecular weight of 584.39 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis[(E)-2-(4-butoxyphenyl)ethenyl]benzene.
| Compound Name | 1,4-dibromo-2,5-bis[(E)-2-(4-butoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 86600085 |
| Molecular Formula | C30H32Br2O2 |
| Molecular Weight | 584.39 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | 1,4-dibromo-2,5-bis[(E)-2-(4-butoxyphenyl)ethenyl]benzene |
| SMILES | CCCCOc1ccc(/C=C/c2cc(Br)c(/C=C/c3ccc(OCCCC)cc3)cc2Br)cc1 |
| InChI | InChI=1S/C30H32Br2O2/c1-3-5-19-33-27-15-9-23(10-16-27)7-13-25-21-30(32)26(22-29(25)31)14-8-24-11-17-28(18-12-24)34-20-6-4-2/h7-18,21-22H,3-6,19-20H2,1-2H3/b13-7+,14-8+ |
| InChIKey | LEQHCDSDSLHWIB-FNCQTZNRSA-N |
| XLogP | 9.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.39 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|