C28H28Br2O8S2 — CID 101432965
3-[4-[(E)-2-[2,5-dibromo-4-[(E)-2-[4-(3-sulfopropoxy)phenyl]ethenyl]phenyl]ethenyl]phenoxy]propane-1-sulfonic acid (PubChem CID 101432965) has the molecular formula C28H28Br2O8S2 and a molecular weight of 716.47 g/mol. Its IUPAC name is 3-[4-[(E)-2-[2,5-dibromo-4-[(E)-2-[4-(3-sulfopropoxy)phenyl]ethenyl]phenyl]ethenyl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[4-[(E)-2-[2,5-dibromo-4-[(E)-2-[4-(3-sulfopropoxy)phenyl]ethenyl]phenyl]ethenyl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 101432965 |
| Molecular Formula | C28H28Br2O8S2 |
| Molecular Weight | 716.47 g/mol |
| Exact Mass | 713.96 |
| IUPAC Name | 3-[4-[(E)-2-[2,5-dibromo-4-[(E)-2-[4-(3-sulfopropoxy)phenyl]ethenyl]phenyl]ethenyl]phenoxy]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOc1ccc(/C=C/c2cc(Br)c(/C=C/c3ccc(OCCCS(=O)(=O)O)cc3)cc2Br)cc1 |
| InChI | InChI=1S/C28H28Br2O8S2/c29-27-20-24(10-4-22-7-13-26(14-8-22)38-16-2-18-40(34,35)36)28(30)19-23(27)9-3-21-5-11-25(12-6-21)37-15-1-17-39(31,32)33/h3-14,19-20H,1-2,15-18H2,(H,31,32,33)(H,34,35,36)/b9-3+,10-4+ |
| InChIKey | RTNWHPHLUUCPKG-LQIBPGRFSA-N |
| XLogP | 6.87 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|