C32H32O7S2 — CID 88944607
3-[4-[(E)-2-[4-(3-hydroperoxysulfanylpropoxy)phenyl]-1,2-diphenylethenyl]phenoxy]propane-1-sulfonic acid (PubChem CID 88944607) has the molecular formula C32H32O7S2 and a molecular weight of 592.74 g/mol. Its IUPAC name is 3-[4-[(E)-2-[4-(3-hydroperoxysulfanylpropoxy)phenyl]-1,2-diphenylethenyl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[4-[(E)-2-[4-(3-hydroperoxysulfanylpropoxy)phenyl]-1,2-diphenylethenyl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88944607 |
| Molecular Formula | C32H32O7S2 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 3-[4-[(E)-2-[4-(3-hydroperoxysulfanylpropoxy)phenyl]-1,2-diphenylethenyl]phenoxy]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOc1ccc(/C(=C(\c2ccccc2)c2ccc(OCCCSOO)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H32O7S2/c33-39-40-23-7-21-37-29-17-13-27(14-18-29)31(25-9-3-1-4-10-25)32(26-11-5-2-6-12-26)28-15-19-30(20-16-28)38-22-8-24-41(34,35)36/h1-6,9-20,33H,7-8,21-24H2,(H,34,35,36)/b32-31+ |
| InChIKey | CSEOEPIJJHLWEE-QNEJGDQOSA-N |
| XLogP | 7.26 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|