C38H43NaO5S — CID 172972787
sodium 4-[4-[2-(4-octoxyphenyl)-1,2-diphenylethenyl]phenoxy]butane-1-sulfonate (PubChem CID 172972787) has the molecular formula C38H43NaO5S and a molecular weight of 634.81 g/mol. Its IUPAC name is sodium 4-[4-[2-(4-octoxyphenyl)-1,2-diphenylethenyl]phenoxy]butane-1-sulfonate.
| Compound Name | sodium 4-[4-[2-(4-octoxyphenyl)-1,2-diphenylethenyl]phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 172972787 |
| Molecular Formula | C38H43NaO5S |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | sodium 4-[4-[2-(4-octoxyphenyl)-1,2-diphenylethenyl]phenoxy]butane-1-sulfonate |
| SMILES | CCCCCCCCOc1ccc(C(=C(c2ccccc2)c2ccc(OCCCCS(=O)(=O)[O-])cc2)c2ccccc2)cc1.[Na+] |
| InChI | InChI=1S/C38H44O5S.Na/c1-2-3-4-5-6-13-28-42-35-24-20-33(21-25-35)37(31-16-9-7-10-17-31)38(32-18-11-8-12-19-32)34-22-26-36(27-23-34)43-29-14-15-30-44(39,40)41;/h7-12,16-27H,2-6,13-15,28-30H2,1H3,(H,39,40,41);/q;+1/p-1 |
| InChIKey | SLSFEFIICUHJRV-UHFFFAOYSA-M |
| XLogP | 6.14 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|