C46H64Br2N2O2 — CID 159603734
4-[4-[(E)-1,2-diphenyl-2-[4-[4-(triethylazaniumyl)butoxy]phenyl]ethenyl]phenoxy]butyl-triethylazanium dibromide (PubChem CID 159603734) has the molecular formula C46H64Br2N2O2 and a molecular weight of 836.84 g/mol. Its IUPAC name is 4-[4-[(E)-1,2-diphenyl-2-[4-[4-(triethylazaniumyl)butoxy]phenyl]ethenyl]phenoxy]butyl-triethylazanium dibromide.
| Compound Name | 4-[4-[(E)-1,2-diphenyl-2-[4-[4-(triethylazaniumyl)butoxy]phenyl]ethenyl]phenoxy]butyl-triethylazanium dibromide |
|---|---|
| PubChem CID | 159603734 |
| Molecular Formula | C46H64Br2N2O2 |
| Molecular Weight | 836.84 g/mol |
| Exact Mass | 834.33 |
| IUPAC Name | 4-[4-[(E)-1,2-diphenyl-2-[4-[4-(triethylazaniumyl)butoxy]phenyl]ethenyl]phenoxy]butyl-triethylazanium dibromide |
| SMILES | CC[N+](CC)(CC)CCCCOc1ccc(/C(=C(\c2ccccc2)c2ccc(OCCCC[N+](CC)(CC)CC)cc2)c2ccccc2)cc1.[Br-].[Br-] |
| InChI | InChI=1S/C46H64N2O2.2BrH/c1-7-47(8-2,9-3)35-19-21-37-49-43-31-27-41(28-32-43)45(39-23-15-13-16-24-39)46(40-25-17-14-18-26-40)42-29-33-44(34-30-42)50-38-22-20-36-48(10-4,11-5)12-6;;/h13-18,23-34H,7-12,19-22,35-38H2,1-6H3;2*1H/q+2;;/p-2/b46-45+;; |
| InChIKey | XDMMTIVSKCWYFB-DWOVJRQWSA-L |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.84 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|