C38H38NO+ — CID 139213254
2-[4-[2,2-bis(4-ethynylphenyl)-1-phenylethenyl]phenoxy]ethyl-triethylazanium (PubChem CID 139213254) has the molecular formula C38H38NO+ and a molecular weight of 524.73 g/mol. Its IUPAC name is 2-[4-[2,2-bis(4-ethynylphenyl)-1-phenylethenyl]phenoxy]ethyl-triethylazanium.
| Compound Name | 2-[4-[2,2-bis(4-ethynylphenyl)-1-phenylethenyl]phenoxy]ethyl-triethylazanium |
|---|---|
| PubChem CID | 139213254 |
| Molecular Formula | C38H38NO+ |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 2-[4-[2,2-bis(4-ethynylphenyl)-1-phenylethenyl]phenoxy]ethyl-triethylazanium |
| SMILES | C#Cc1ccc(C(=C(c2ccccc2)c2ccc(OCC[N+](CC)(CC)CC)cc2)c2ccc(C#C)cc2)cc1 |
| InChI | InChI=1S/C38H38NO/c1-6-30-16-20-33(21-17-30)38(34-22-18-31(7-2)19-23-34)37(32-14-12-11-13-15-32)35-24-26-36(27-25-35)40-29-28-39(8-3,9-4)10-5/h1-2,11-27H,8-10,28-29H2,3-5H3/q+1 |
| InChIKey | BOOZIGBGGUNBQZ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|