C30H26N6O2 — CID 53348773
1-(2-azidoethoxy)-4-[(E)-2-[4-(2-azidoethoxy)phenyl]-1,2-diphenylethenyl]benzene (PubChem CID 53348773) has the molecular formula C30H26N6O2 and a molecular weight of 502.58 g/mol. Its IUPAC name is 1-(2-azidoethoxy)-4-[(E)-2-[4-(2-azidoethoxy)phenyl]-1,2-diphenylethenyl]benzene.
| Compound Name | 1-(2-azidoethoxy)-4-[(E)-2-[4-(2-azidoethoxy)phenyl]-1,2-diphenylethenyl]benzene |
|---|---|
| PubChem CID | 53348773 |
| Molecular Formula | C30H26N6O2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 1-(2-azidoethoxy)-4-[(E)-2-[4-(2-azidoethoxy)phenyl]-1,2-diphenylethenyl]benzene |
| SMILES | [N-]=[N+]=NCCOc1ccc(/C(=C(\c2ccccc2)c2ccc(OCCN=[N+]=[N-])cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26N6O2/c31-35-33-19-21-37-27-15-11-25(12-16-27)29(23-7-3-1-4-8-23)30(24-9-5-2-6-10-24)26-13-17-28(18-14-26)38-22-20-34-36-32/h1-18H,19-22H2/b30-29+ |
| InChIKey | BKTBSBANPFPBPC-QVIHXGFCSA-N |
| XLogP | 8.07 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|