C38H42N6O2 — CID 102424524
1-(6-azidohexoxy)-4-[(E)-2-[4-(6-azidohexoxy)phenyl]-1,2-diphenylethenyl]benzene (PubChem CID 102424524) has the molecular formula C38H42N6O2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 1-(6-azidohexoxy)-4-[(E)-2-[4-(6-azidohexoxy)phenyl]-1,2-diphenylethenyl]benzene.
| Compound Name | 1-(6-azidohexoxy)-4-[(E)-2-[4-(6-azidohexoxy)phenyl]-1,2-diphenylethenyl]benzene |
|---|---|
| PubChem CID | 102424524 |
| Molecular Formula | C38H42N6O2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | 1-(6-azidohexoxy)-4-[(E)-2-[4-(6-azidohexoxy)phenyl]-1,2-diphenylethenyl]benzene |
| SMILES | [N-]=[N+]=NCCCCCCOc1ccc(/C(=C(\c2ccccc2)c2ccc(OCCCCCCN=[N+]=[N-])cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H42N6O2/c39-43-41-27-11-1-3-13-29-45-35-23-19-33(20-24-35)37(31-15-7-5-8-16-31)38(32-17-9-6-10-18-32)34-21-25-36(26-22-34)46-30-14-4-2-12-28-42-44-40/h5-10,15-26H,1-4,11-14,27-30H2/b38-37+ |
| InChIKey | ZNFJADLYHLOWFG-HEFFKOSUSA-N |
| XLogP | 11.19 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|