C23H18F3N3O — CID 54272184
1-(2-azidoethoxy)-4-(3,3,3-trifluoro-1,2-diphenylprop-1-enyl)benzene (PubChem CID 54272184) has the molecular formula C23H18F3N3O and a molecular weight of 409.41 g/mol. Its IUPAC name is 1-(2-azidoethoxy)-4-(3,3,3-trifluoro-1,2-diphenylprop-1-enyl)benzene.
| Compound Name | 1-(2-azidoethoxy)-4-(3,3,3-trifluoro-1,2-diphenylprop-1-enyl)benzene |
|---|---|
| PubChem CID | 54272184 |
| Molecular Formula | C23H18F3N3O |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-(2-azidoethoxy)-4-(3,3,3-trifluoro-1,2-diphenylprop-1-enyl)benzene |
| SMILES | [N-]=[N+]=NCCOc1ccc(C(=C(c2ccccc2)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18F3N3O/c24-23(25,26)22(19-9-5-2-6-10-19)21(17-7-3-1-4-8-17)18-11-13-20(14-12-18)30-16-15-28-29-27/h1-14H,15-16H2 |
| InChIKey | RKXXDPOIOWRHNT-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|