C25H26F3NO5S — CID 70377377
N,N-dimethyl-2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethanamine;sulfuric acid (PubChem CID 70377377) has the molecular formula C25H26F3NO5S and a molecular weight of 509.55 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethanamine;sulfuric acid.
| Compound Name | N,N-dimethyl-2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethanamine;sulfuric acid |
|---|---|
| PubChem CID | 70377377 |
| Molecular Formula | C25H26F3NO5S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | N,N-dimethyl-2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethanamine;sulfuric acid |
| SMILES | CN(C)CCOc1ccc(/C(=C(\c2ccccc2)C(F)(F)F)c2ccccc2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C25H24F3NO.H2O4S/c1-29(2)17-18-30-22-15-13-20(14-16-22)23(19-9-5-3-6-10-19)24(25(26,27)28)21-11-7-4-8-12-21;1-5(2,3)4/h3-16H,17-18H2,1-2H3;(H2,1,2,3,4)/b24-23+; |
| InChIKey | JWYHVPQNHSQJEJ-XMXXDQCKSA-N |
| XLogP | 5.50 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|