C26H26F3NO2 — CID 70377420
3-[2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethylamino]propan-1-ol (PubChem CID 70377420) has the molecular formula C26H26F3NO2 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-[2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethylamino]propan-1-ol.
| Compound Name | 3-[2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 70377420 |
| Molecular Formula | C26H26F3NO2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 3-[2-[4-[(E)-3,3,3-trifluoro-1,2-diphenylprop-1-enyl]phenoxy]ethylamino]propan-1-ol |
| SMILES | OCCCNCCOc1ccc(/C(=C(\c2ccccc2)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26F3NO2/c27-26(28,29)25(22-10-5-2-6-11-22)24(20-8-3-1-4-9-20)21-12-14-23(15-13-21)32-19-17-30-16-7-18-31/h1-6,8-15,30-31H,7,16-19H2/b25-24+ |
| InChIKey | WTDMTMGOYKRWOR-OCOZRVBESA-N |
| XLogP | 5.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|