C22H16F4O — CID 21274917
1-fluoro-4-[(Z)-3,3,3-trifluoro-1-(4-methoxyphenyl)-2-phenylprop-1-enyl]benzene (PubChem CID 21274917) has the molecular formula C22H16F4O and a molecular weight of 372.36 g/mol. Its IUPAC name is 1-fluoro-4-[(Z)-3,3,3-trifluoro-1-(4-methoxyphenyl)-2-phenylprop-1-enyl]benzene.
| Compound Name | 1-fluoro-4-[(Z)-3,3,3-trifluoro-1-(4-methoxyphenyl)-2-phenylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 21274917 |
| Molecular Formula | C22H16F4O |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 1-fluoro-4-[(Z)-3,3,3-trifluoro-1-(4-methoxyphenyl)-2-phenylprop-1-enyl]benzene |
| SMILES | COc1ccc(/C(=C(\c2ccccc2)C(F)(F)F)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H16F4O/c1-27-19-13-9-16(10-14-19)20(15-7-11-18(23)12-8-15)21(22(24,25)26)17-5-3-2-4-6-17/h2-14H,1H3/b21-20+ |
| InChIKey | CFGFVCRICOEJSC-QZQOTICOSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|