C18H17F3O2 — CID 10958235
1-methoxy-4-[(Z)-1,1,1-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]benzene (PubChem CID 10958235) has the molecular formula C18H17F3O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-methoxy-4-[(Z)-1,1,1-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]benzene.
| Compound Name | 1-methoxy-4-[(Z)-1,1,1-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]benzene |
|---|---|
| PubChem CID | 10958235 |
| Molecular Formula | C18H17F3O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-methoxy-4-[(Z)-1,1,1-trifluoro-3-(4-methoxyphenyl)but-2-en-2-yl]benzene |
| SMILES | COc1ccc(/C(C)=C(/c2ccc(OC)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3O2/c1-12(13-4-8-15(22-2)9-5-13)17(18(19,20)21)14-6-10-16(23-3)11-7-14/h4-11H,1-3H3/b17-12- |
| InChIKey | UZLNLXJOMFRVFD-ATVHPVEESA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|