C22H17F3OS — CID 102466577
1-methoxy-4-[(E)-3,3,3-trifluoro-2-phenyl-1-phenylsulfanylprop-1-enyl]benzene (PubChem CID 102466577) has the molecular formula C22H17F3OS and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-3,3,3-trifluoro-2-phenyl-1-phenylsulfanylprop-1-enyl]benzene.
| Compound Name | 1-methoxy-4-[(E)-3,3,3-trifluoro-2-phenyl-1-phenylsulfanylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 102466577 |
| Molecular Formula | C22H17F3OS |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-methoxy-4-[(E)-3,3,3-trifluoro-2-phenyl-1-phenylsulfanylprop-1-enyl]benzene |
| SMILES | COc1ccc(/C(Sc2ccccc2)=C(/c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H17F3OS/c1-26-18-14-12-17(13-15-18)21(27-19-10-6-3-7-11-19)20(22(23,24)25)16-8-4-2-5-9-16/h2-15H,1H3/b21-20+ |
| InChIKey | PMYBXQWQCAOULA-QZQOTICOSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|