C15H14F2OS — CID 132608190
1-(2,2-difluoro-2-phenylsulfanylethyl)-4-methoxybenzene (PubChem CID 132608190) has the molecular formula C15H14F2OS and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-(2,2-difluoro-2-phenylsulfanylethyl)-4-methoxybenzene.
| Compound Name | 1-(2,2-difluoro-2-phenylsulfanylethyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 132608190 |
| Molecular Formula | C15H14F2OS |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-(2,2-difluoro-2-phenylsulfanylethyl)-4-methoxybenzene |
| SMILES | COc1ccc(CC(F)(F)Sc2ccccc2)cc1 |
| InChI | InChI=1S/C15H14F2OS/c1-18-13-9-7-12(8-10-13)11-15(16,17)19-14-5-3-2-4-6-14/h2-10H,11H2,1H3 |
| InChIKey | QGTRMSADJZTNJT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |