C10H10F4O — CID 132937165
1-methoxy-4-(2,2,3,3-tetrafluoropropyl)benzene (PubChem CID 132937165) has the molecular formula C10H10F4O and a molecular weight of 222.18 g/mol. Its IUPAC name is 1-methoxy-4-(2,2,3,3-tetrafluoropropyl)benzene.
| Compound Name | 1-methoxy-4-(2,2,3,3-tetrafluoropropyl)benzene |
|---|---|
| PubChem CID | 132937165 |
| Molecular Formula | C10H10F4O |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-methoxy-4-(2,2,3,3-tetrafluoropropyl)benzene |
| SMILES | COc1ccc(CC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H10F4O/c1-15-8-4-2-7(3-5-8)6-10(13,14)9(11)12/h2-5,9H,6H2,1H3 |
| InChIKey | ZAHAYNQGFSHMFK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|