C12H15F4NO2 — CID 106292101
2,2,3,3-tetrafluoro-N-[2-(4-methoxyphenoxy)ethyl]propan-1-amine (PubChem CID 106292101) has the molecular formula C12H15F4NO2 and a molecular weight of 281.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[2-(4-methoxyphenoxy)ethyl]propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-[2-(4-methoxyphenoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 106292101 |
| Molecular Formula | C12H15F4NO2 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[2-(4-methoxyphenoxy)ethyl]propan-1-amine |
| SMILES | COc1ccc(OCCNCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H15F4NO2/c1-18-9-2-4-10(5-3-9)19-7-6-17-8-12(15,16)11(13)14/h2-5,11,17H,6-8H2,1H3 |
| InChIKey | UUWLRBLGTVSGFV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|