C12H17F2NO3 — CID 106176853
2,2-difluoro-3-[2-(4-methoxyphenoxy)ethylamino]propan-1-ol (PubChem CID 106176853) has the molecular formula C12H17F2NO3 and a molecular weight of 261.27 g/mol. Its IUPAC name is 2,2-difluoro-3-[2-(4-methoxyphenoxy)ethylamino]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[2-(4-methoxyphenoxy)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 106176853 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2,2-difluoro-3-[2-(4-methoxyphenoxy)ethylamino]propan-1-ol |
| SMILES | COc1ccc(OCCNCC(F)(F)CO)cc1 |
| InChI | InChI=1S/C12H17F2NO3/c1-17-10-2-4-11(5-3-10)18-7-6-15-8-12(13,14)9-16/h2-5,15-16H,6-9H2,1H3 |
| InChIKey | GHNFUNCHXNADPP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|