C13H20BrNO2 — CID 113293890
3-[2-(4-bromophenoxy)ethylamino]-2,2-dimethylpropan-1-ol (PubChem CID 113293890) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 3-[2-(4-bromophenoxy)ethylamino]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[2-(4-bromophenoxy)ethylamino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 113293890 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-[2-(4-bromophenoxy)ethylamino]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)CNCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H20BrNO2/c1-13(2,10-16)9-15-7-8-17-12-5-3-11(14)4-6-12/h3-6,15-16H,7-10H2,1-2H3 |
| InChIKey | IMLLVYFNJXFPNX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|