C12H17F2NO3 — CID 113462705
3-[(3,5-dimethoxyphenyl)methylamino]-2,2-difluoropropan-1-ol (PubChem CID 113462705) has the molecular formula C12H17F2NO3 and a molecular weight of 261.27 g/mol. Its IUPAC name is 3-[(3,5-dimethoxyphenyl)methylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(3,5-dimethoxyphenyl)methylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 113462705 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-[(3,5-dimethoxyphenyl)methylamino]-2,2-difluoropropan-1-ol |
| SMILES | COc1cc(CNCC(F)(F)CO)cc(OC)c1 |
| InChI | InChI=1S/C12H17F2NO3/c1-17-10-3-9(4-11(5-10)18-2)6-15-7-12(13,14)8-16/h3-5,15-16H,6-8H2,1-2H3 |
| InChIKey | ZHRLHAJYQPQXAF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |