C10H11BrF2N2O3 — CID 106176640
3-[(3-bromo-5-nitrophenyl)methylamino]-2,2-difluoropropan-1-ol (PubChem CID 106176640) has the molecular formula C10H11BrF2N2O3 and a molecular weight of 325.11 g/mol. Its IUPAC name is 3-[(3-bromo-5-nitrophenyl)methylamino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(3-bromo-5-nitrophenyl)methylamino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 106176640 |
| Molecular Formula | C10H11BrF2N2O3 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 3-[(3-bromo-5-nitrophenyl)methylamino]-2,2-difluoropropan-1-ol |
| SMILES | O=[N+]([O-])c1cc(Br)cc(CNCC(F)(F)CO)c1 |
| InChI | InChI=1S/C10H11BrF2N2O3/c11-8-1-7(2-9(3-8)15(17)18)4-14-5-10(12,13)6-16/h1-3,14,16H,4-6H2 |
| InChIKey | IZQCWPBOSVSGEA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|